C12H21NO2 — CID 161131004
(3R,6S)-3,6-dimethyl-4-oxodec-9-enamide (PubChem CID 161131004) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (3R,6S)-3,6-dimethyl-4-oxodec-9-enamide.
| Compound Name | (3R,6S)-3,6-dimethyl-4-oxodec-9-enamide |
|---|---|
| PubChem CID | 161131004 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (3R,6S)-3,6-dimethyl-4-oxodec-9-enamide |
| SMILES | C=CCC[C@H](C)CC(=O)[C@H](C)CC(N)=O |
| InChI | InChI=1S/C12H21NO2/c1-4-5-6-9(2)7-11(14)10(3)8-12(13)15/h4,9-10H,1,5-8H2,2-3H3,(H2,13,15)/t9-,10+/m0/s1 |
| InChIKey | QUYOLKJYMZAZGZ-VHSXEESVSA-N |
| XLogP | 2.06 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|