C11H21N3O — CID 163999465
N'-[(1E)-2-amino-4-methylocta-1,7-dienyl]acetohydrazide (PubChem CID 163999465) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is N'-[(1E)-2-amino-4-methylocta-1,7-dienyl]acetohydrazide.
| Compound Name | N'-[(1E)-2-amino-4-methylocta-1,7-dienyl]acetohydrazide |
|---|---|
| PubChem CID | 163999465 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N'-[(1E)-2-amino-4-methylocta-1,7-dienyl]acetohydrazide |
| SMILES | C=CCCC(C)C/C(N)=C\NNC(C)=O |
| InChI | InChI=1S/C11H21N3O/c1-4-5-6-9(2)7-11(12)8-13-14-10(3)15/h4,8-9,13H,1,5-7,12H2,2-3H3,(H,14,15)/b11-8+ |
| InChIKey | UHQZYELNUMHRLH-DHZHZOJOSA-N |
| XLogP | 1.42 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|