About 3-propan-2-yl-5,7a-dihydro-4aH-pyrrolo[3,4-b]pyridine
3-propan-2-yl-5,7a-dihydro-4aH-pyrrolo[3,4-b]pyridine (PubChem CID 157071248) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 3-propan-2-yl-5,7a-dihydro-4aH-pyrrolo[3,4-b]pyridine.
Analyze 3-propan-2-yl-5,7a-dihydro-4aH-pyrrolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-5,7a-dihydro-4aH-pyrrolo[3,4-b]pyridine?
The IUPAC name of 3-propan-2-yl-5,7a-dihydro-4aH-pyrrolo[3,4-b]pyridine (CID 157071248) is 3-propan-2-yl-5,7a-dihydro-4aH-pyrrolo[3,4-b]pyridine.
What is the SMILES notation for 3-propan-2-yl-5,7a-dihydro-4aH-pyrrolo[3,4-b]pyridine?
The canonical SMILES for 3-propan-2-yl-5,7a-dihydro-4aH-pyrrolo[3,4-b]pyridine is CC(C)C1=CC2CN=CC2N=C1.
What is the InChIKey of 3-propan-2-yl-5,7a-dihydro-4aH-pyrrolo[3,4-b]pyridine?
The InChIKey is MIYCFISCQAHJPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-7(2)8-3-9-4-11-6-10(9)12-5-8/h3,5-7,9-10H,4H2,1-2H3.
What are the key properties of 3-propan-2-yl-5,7a-dihydro-4aH-pyrrolo[3,4-b]pyridine?
3-propan-2-yl-5,7a-dihydro-4aH-pyrrolo[3,4-b]pyridine has a molecular weight of 162.24 g/mol, XLogP of 1.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-5,7a-dihydro-4aH-pyrrolo[3,4-b]pyridine is sourced from PubChem (CID 157071248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).