C25H23N5O3 — CID 157072301
7-(2-hydroxynaphthalen-1-yl)-6-methyl-4-(4-prop-2-enoylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-8-one (PubChem CID 157072301) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is 7-(2-hydroxynaphthalen-1-yl)-6-methyl-4-(4-prop-2-enoylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-8-one.
| Compound Name | 7-(2-hydroxynaphthalen-1-yl)-6-methyl-4-(4-prop-2-enoylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-8-one |
|---|---|
| PubChem CID | 157072301 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 7-(2-hydroxynaphthalen-1-yl)-6-methyl-4-(4-prop-2-enoylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-8-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c(=O)n(-c4c(O)ccc5ccccc45)c(C)cc23)CC1 |
| InChI | InChI=1S/C25H23N5O3/c1-3-21(32)28-10-12-29(13-11-28)24-19-14-16(2)30(25(33)22(19)26-15-27-24)23-18-7-5-4-6-17(18)8-9-20(23)31/h3-9,14-15,31H,1,10-13H2,2H3 |
| InChIKey | STEUTWZVJKWWER-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|