C22H21Cl2FN6O2 — CID 157447131
7-(2-amino-3,5-dichloro-6-fluorophenyl)-6-methyl-4-[(2R)-2-methyl-4-prop-2-enoylpiperazin-1-yl]pyrido[3,4-d]pyrimidin-8-one (PubChem CID 157447131) has the molecular formula C22H21Cl2FN6O2 and a molecular weight of 491.35 g/mol. Its IUPAC name is 7-(2-amino-3,5-dichloro-6-fluorophenyl)-6-methyl-4-[(2R)-2-methyl-4-prop-2-enoylpiperazin-1-yl]pyrido[3,4-d]pyrimidin-8-one.
| Compound Name | 7-(2-amino-3,5-dichloro-6-fluorophenyl)-6-methyl-4-[(2R)-2-methyl-4-prop-2-enoylpiperazin-1-yl]pyrido[3,4-d]pyrimidin-8-one |
|---|---|
| PubChem CID | 157447131 |
| Molecular Formula | C22H21Cl2FN6O2 |
| Molecular Weight | 491.35 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 7-(2-amino-3,5-dichloro-6-fluorophenyl)-6-methyl-4-[(2R)-2-methyl-4-prop-2-enoylpiperazin-1-yl]pyrido[3,4-d]pyrimidin-8-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c(=O)n(-c4c(N)c(Cl)cc(Cl)c4F)c(C)cc23)[C@H](C)C1 |
| InChI | InChI=1S/C22H21Cl2FN6O2/c1-4-16(32)29-5-6-30(12(3)9-29)21-13-7-11(2)31(22(33)19(13)27-10-28-21)20-17(25)14(23)8-15(24)18(20)26/h4,7-8,10,12H,1,5-6,9,26H2,2-3H3/t12-/m1/s1 |
| InChIKey | JJYZTQUBRFZZEE-GFCCVEGCSA-N |
| XLogP | 3.34 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|