C22H17Cl2F5N6O2 — CID 172844861
7-(2-amino-3,5-dichloro-6-fluorophenyl)-4-[(2S)-4-(2-fluoroprop-2-enoyl)-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyrido[2,1-f][1,2,4]triazin-8-one (PubChem CID 172844861) has the molecular formula C22H17Cl2F5N6O2 and a molecular weight of 563.31 g/mol. Its IUPAC name is 7-(2-amino-3,5-dichloro-6-fluorophenyl)-4-[(2S)-4-(2-fluoroprop-2-enoyl)-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyrido[2,1-f][1,2,4]triazin-8-one.
| Compound Name | 7-(2-amino-3,5-dichloro-6-fluorophenyl)-4-[(2S)-4-(2-fluoroprop-2-enoyl)-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyrido[2,1-f][1,2,4]triazin-8-one |
|---|---|
| PubChem CID | 172844861 |
| Molecular Formula | C22H17Cl2F5N6O2 |
| Molecular Weight | 563.31 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | 7-(2-amino-3,5-dichloro-6-fluorophenyl)-4-[(2S)-4-(2-fluoroprop-2-enoyl)-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyrido[2,1-f][1,2,4]triazin-8-one |
| SMILES | C=C(F)C(=O)N1CCN(c2ncnn3c(=O)c(-c4c(N)c(Cl)cc(Cl)c4F)c(C(F)(F)F)cc23)[C@@H](C)C1 |
| InChI | InChI=1S/C22H17Cl2F5N6O2/c1-9-7-33(20(36)10(2)25)3-4-34(9)19-14-5-11(22(27,28)29)15(21(37)35(14)32-8-31-19)16-17(26)12(23)6-13(24)18(16)30/h5-6,8-9H,2-4,7,30H2,1H3/t9-/m0/s1 |
| InChIKey | XGYAREMAAPRJCM-VIFPVBQESA-N |
| XLogP | 4.32 |
| TPSA | 96.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|