C27H29Cl2F4N7O2 — CID 172783109
7-(2-amino-3,5-dichloro-6-fluorophenyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(2S)-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyrido[2,1-f][1,2,4]triazin-8-one (PubChem CID 172783109) has the molecular formula C27H29Cl2F4N7O2 and a molecular weight of 630.47 g/mol. Its IUPAC name is 7-(2-amino-3,5-dichloro-6-fluorophenyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(2S)-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyrido[2,1-f][1,2,4]triazin-8-one.
| Compound Name | 7-(2-amino-3,5-dichloro-6-fluorophenyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(2S)-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyrido[2,1-f][1,2,4]triazin-8-one |
|---|---|
| PubChem CID | 172783109 |
| Molecular Formula | C27H29Cl2F4N7O2 |
| Molecular Weight | 630.47 g/mol |
| Exact Mass | 629.17 |
| IUPAC Name | 7-(2-amino-3,5-dichloro-6-fluorophenyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(2S)-2-methylpiperazin-1-yl]-6-(trifluoromethyl)pyrido[2,1-f][1,2,4]triazin-8-one |
| SMILES | C[C@H]1CNCCN1c1nc(OCC23CCCN2CCC3)nn2c(=O)c(-c3c(N)c(Cl)cc(Cl)c3F)c(C(F)(F)F)cc12 |
| InChI | InChI=1S/C27H29Cl2F4N7O2/c1-14-12-35-6-9-39(14)23-18-10-15(27(31,32)33)19(20-21(30)16(28)11-17(29)22(20)34)24(41)40(18)37-25(36-23)42-13-26-4-2-7-38(26)8-3-5-26/h10-11,14,35H,2-9,12-13,34H2,1H3/t14-/m0/s1 |
| InChIKey | ONIGWOWIJGYEQQ-AWEZNQCLSA-N |
| XLogP | 4.61 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|