C20H15Cl2F4N7O — CID 172703778
(3S)-4-[7-(2-amino-3,5-dichloro-6-fluorophenyl)-8-oxo-6-(trifluoromethyl)pyrido[2,1-f][1,2,4]triazin-4-yl]-3-methylpiperazine-1-carbonitrile (PubChem CID 172703778) has the molecular formula C20H15Cl2F4N7O and a molecular weight of 516.29 g/mol. Its IUPAC name is (3S)-4-[7-(2-amino-3,5-dichloro-6-fluorophenyl)-8-oxo-6-(trifluoromethyl)pyrido[2,1-f][1,2,4]triazin-4-yl]-3-methylpiperazine-1-carbonitrile.
| Compound Name | (3S)-4-[7-(2-amino-3,5-dichloro-6-fluorophenyl)-8-oxo-6-(trifluoromethyl)pyrido[2,1-f][1,2,4]triazin-4-yl]-3-methylpiperazine-1-carbonitrile |
|---|---|
| PubChem CID | 172703778 |
| Molecular Formula | C20H15Cl2F4N7O |
| Molecular Weight | 516.29 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | (3S)-4-[7-(2-amino-3,5-dichloro-6-fluorophenyl)-8-oxo-6-(trifluoromethyl)pyrido[2,1-f][1,2,4]triazin-4-yl]-3-methylpiperazine-1-carbonitrile |
| SMILES | C[C@H]1CN(C#N)CCN1c1ncnn2c(=O)c(-c3c(N)c(Cl)cc(Cl)c3F)c(C(F)(F)F)cc12 |
| InChI | InChI=1S/C20H15Cl2F4N7O/c1-9-6-31(7-27)2-3-32(9)18-13-4-10(20(24,25)26)14(19(34)33(13)30-8-29-18)15-16(23)11(21)5-12(22)17(15)28/h4-5,8-9H,2-3,6,28H2,1H3/t9-/m0/s1 |
| InChIKey | DHTGRITZCGHMSV-VIFPVBQESA-N |
| XLogP | 3.79 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|