C12H21F3O2S — CID 157077768
tert-butyl (3S)-3-methyl-4-(3,3,3-trifluoropropylsulfanyl)butanoate (PubChem CID 157077768) has the molecular formula C12H21F3O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is tert-butyl (3S)-3-methyl-4-(3,3,3-trifluoropropylsulfanyl)butanoate.
| Compound Name | tert-butyl (3S)-3-methyl-4-(3,3,3-trifluoropropylsulfanyl)butanoate |
|---|---|
| PubChem CID | 157077768 |
| Molecular Formula | C12H21F3O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | tert-butyl (3S)-3-methyl-4-(3,3,3-trifluoropropylsulfanyl)butanoate |
| SMILES | C[C@H](CSCCC(F)(F)F)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21F3O2S/c1-9(7-10(16)17-11(2,3)4)8-18-6-5-12(13,14)15/h9H,5-8H2,1-4H3/t9-/m0/s1 |
| InChIKey | ADEFAWLUBVNJOP-VIFPVBQESA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|