C10H7ClN4OS — CID 15707933
7-(4-chlorophenyl)-3-sulfanylidene-2,5-dihydroimidazo[2,1-c][1,2,4]triazol-6-one (PubChem CID 15707933) has the molecular formula C10H7ClN4OS and a molecular weight of 266.71 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-3-sulfanylidene-2,5-dihydroimidazo[2,1-c][1,2,4]triazol-6-one.
| Compound Name | 7-(4-chlorophenyl)-3-sulfanylidene-2,5-dihydroimidazo[2,1-c][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 15707933 |
| Molecular Formula | C10H7ClN4OS |
| Molecular Weight | 266.71 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 7-(4-chlorophenyl)-3-sulfanylidene-2,5-dihydroimidazo[2,1-c][1,2,4]triazol-6-one |
| SMILES | O=C1Cn2c(n[nH]c2=S)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H7ClN4OS/c11-6-1-3-7(4-2-6)15-8(16)5-14-9(15)12-13-10(14)17/h1-4H,5H2,(H,13,17) |
| InChIKey | XFRIYZZJQOCUIJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|