C13H9F4N5 — CID 157079623
N-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-7H-purin-2-amine (PubChem CID 157079623) has the molecular formula C13H9F4N5 and a molecular weight of 311.24 g/mol. Its IUPAC name is N-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-7H-purin-2-amine.
| Compound Name | N-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 157079623 |
| Molecular Formula | C13H9F4N5 |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-7H-purin-2-amine |
| SMILES | Fc1cccc(C(F)(F)F)c1CNc1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C13H9F4N5/c14-9-3-1-2-8(13(15,16)17)7(9)4-18-12-19-5-10-11(22-12)21-6-20-10/h1-3,5-6H,4H2,(H2,18,19,20,21,22) |
| InChIKey | ADJNOCXDKJLOJG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |