C14H14FN5O2 — CID 141225935
N-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-7H-purin-2-amine (PubChem CID 141225935) has the molecular formula C14H14FN5O2 and a molecular weight of 303.30 g/mol. Its IUPAC name is N-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-7H-purin-2-amine.
| Compound Name | N-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 141225935 |
| Molecular Formula | C14H14FN5O2 |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-[(2-fluoro-4,5-dimethoxyphenyl)methyl]-7H-purin-2-amine |
| SMILES | COc1cc(F)c(CNc2ncc3[nH]cnc3n2)cc1OC |
| InChI | InChI=1S/C14H14FN5O2/c1-21-11-3-8(9(15)4-12(11)22-2)5-16-14-17-6-10-13(20-14)19-7-18-10/h3-4,6-7H,5H2,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | NWPDSULPKMVXCX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |