C12H11N5O — CID 161411185
2-[(7H-purin-2-ylamino)methyl]phenol (PubChem CID 161411185) has the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-[(7H-purin-2-ylamino)methyl]phenol.
| Compound Name | 2-[(7H-purin-2-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 161411185 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-[(7H-purin-2-ylamino)methyl]phenol |
| SMILES | Oc1ccccc1CNc1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C12H11N5O/c18-10-4-2-1-3-8(10)5-13-12-14-6-9-11(17-12)16-7-15-9/h1-4,6-7,18H,5H2,(H2,13,14,15,16,17) |
| InChIKey | VVMIUNHEBBELNZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|