C11H8N4O3 — CID 150201639
4-(7H-purin-2-yloxy)benzene-1,2-diol (PubChem CID 150201639) has the molecular formula C11H8N4O3 and a molecular weight of 244.21 g/mol. Its IUPAC name is 4-(7H-purin-2-yloxy)benzene-1,2-diol.
| Compound Name | 4-(7H-purin-2-yloxy)benzene-1,2-diol |
|---|---|
| PubChem CID | 150201639 |
| Molecular Formula | C11H8N4O3 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4-(7H-purin-2-yloxy)benzene-1,2-diol |
| SMILES | Oc1ccc(Oc2ncc3[nH]cnc3n2)cc1O |
| InChI | InChI=1S/C11H8N4O3/c16-8-2-1-6(3-9(8)17)18-11-12-4-7-10(15-11)14-5-13-7/h1-5,16-17H,(H,12,13,14,15) |
| InChIKey | FPPQGGSCKCPTCD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|