C14H15N5O2 — CID 139958757
4-[3-(7H-purin-2-ylamino)propyl]benzene-1,2-diol (PubChem CID 139958757) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 4-[3-(7H-purin-2-ylamino)propyl]benzene-1,2-diol.
| Compound Name | 4-[3-(7H-purin-2-ylamino)propyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 139958757 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-[3-(7H-purin-2-ylamino)propyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CCCNc2ncc3[nH]cnc3n2)cc1O |
| InChI | InChI=1S/C14H15N5O2/c20-11-4-3-9(6-12(11)21)2-1-5-15-14-16-7-10-13(19-14)18-8-17-10/h3-4,6-8,20-21H,1-2,5H2,(H2,15,16,17,18,19) |
| InChIKey | KOFZEMBLQSBPMX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|