C28H30FN5O6S2 — CID 157080062
2-[3-[(5R,10R)-8-amino-2-(benzenesulfonyl)-7,10-dimethyl-6,6-dioxo-6λ6-thia-2,7,9-triazaspiro[4.5]dec-8-en-10-yl]-4-fluorophenyl]-1-(5-methoxy-2-pyridinyl)ethanone (PubChem CID 157080062) has the molecular formula C28H30FN5O6S2 and a molecular weight of 615.71 g/mol. Its IUPAC name is 2-[3-[(5R,10R)-8-amino-2-(benzenesulfonyl)-7,10-dimethyl-6,6-dioxo-6λ6-thia-2,7,9-triazaspiro[4.5]dec-8-en-10-yl]-4-fluorophenyl]-1-(5-methoxy-2-pyridinyl)ethanone.
| Compound Name | 2-[3-[(5R,10R)-8-amino-2-(benzenesulfonyl)-7,10-dimethyl-6,6-dioxo-6λ6-thia-2,7,9-triazaspiro[4.5]dec-8-en-10-yl]-4-fluorophenyl]-1-(5-methoxy-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 157080062 |
| Molecular Formula | C28H30FN5O6S2 |
| Molecular Weight | 615.71 g/mol |
| Exact Mass | 615.16 |
| IUPAC Name | 2-[3-[(5R,10R)-8-amino-2-(benzenesulfonyl)-7,10-dimethyl-6,6-dioxo-6λ6-thia-2,7,9-triazaspiro[4.5]dec-8-en-10-yl]-4-fluorophenyl]-1-(5-methoxy-2-pyridinyl)ethanone |
| SMILES | COc1ccc(C(=O)Cc2ccc(F)c([C@@]3(C)N=C(N)N(C)S(=O)(=O)[C@@]34CCN(S(=O)(=O)c3ccccc3)C4)c2)nc1 |
| InChI | InChI=1S/C28H30FN5O6S2/c1-27(22-15-19(9-11-23(22)29)16-25(35)24-12-10-20(40-3)17-31-24)28(42(38,39)33(2)26(30)32-27)13-14-34(18-28)41(36,37)21-7-5-4-6-8-21/h4-12,15,17H,13-14,16,18H2,1-3H3,(H2,30,32)/t27-,28-/m1/s1 |
| InChIKey | ADKWLKBSJRDKPW-VSGBNLITSA-N |
| XLogP | 2.29 |
| TPSA | 152.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.71 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |