C22H31FN6O4S — CID 137468703
N-[5-[(5R,10R)-8-amino-2,7,10-trimethyl-6,6-dioxo-6λ6-thia-2,7,9-triazaspiro[4.5]dec-8-en-10-yl]-4-fluorocyclohex-3-en-1-yl]-5-methoxypyridine-2-carboxamide (PubChem CID 137468703) has the molecular formula C22H31FN6O4S and a molecular weight of 494.59 g/mol. Its IUPAC name is N-[5-[(5R,10R)-8-amino-2,7,10-trimethyl-6,6-dioxo-6λ6-thia-2,7,9-triazaspiro[4.5]dec-8-en-10-yl]-4-fluorocyclohex-3-en-1-yl]-5-methoxypyridine-2-carboxamide.
| Compound Name | N-[5-[(5R,10R)-8-amino-2,7,10-trimethyl-6,6-dioxo-6λ6-thia-2,7,9-triazaspiro[4.5]dec-8-en-10-yl]-4-fluorocyclohex-3-en-1-yl]-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 137468703 |
| Molecular Formula | C22H31FN6O4S |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N-[5-[(5R,10R)-8-amino-2,7,10-trimethyl-6,6-dioxo-6λ6-thia-2,7,9-triazaspiro[4.5]dec-8-en-10-yl]-4-fluorocyclohex-3-en-1-yl]-5-methoxypyridine-2-carboxamide |
| SMILES | COc1ccc(C(=O)NC2CC=C(F)C([C@@]3(C)N=C(N)N(C)S(=O)(=O)[C@@]34CCN(C)C4)C2)nc1 |
| InChI | InChI=1S/C22H31FN6O4S/c1-21(22(9-10-28(2)13-22)34(31,32)29(3)20(24)27-21)16-11-14(5-7-17(16)23)26-19(30)18-8-6-15(33-4)12-25-18/h6-8,12,14,16H,5,9-11,13H2,1-4H3,(H2,24,27)(H,26,30)/t14?,16?,21-,22-/m1/s1 |
| InChIKey | JSJSJTCCEZZRRK-NEJLQBHCSA-N |
| XLogP | 0.87 |
| TPSA | 130.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |