C48H40BClN6O2 — CID 157082064
2-(3-chlorophenyl)-4,6-diphenyl-1,3,5-triazine;2,4-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine (PubChem CID 157082064) has the molecular formula C48H40BClN6O2 and a molecular weight of 779.15 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4,6-diphenyl-1,3,5-triazine;2,4-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(3-chlorophenyl)-4,6-diphenyl-1,3,5-triazine;2,4-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 157082064 |
| Molecular Formula | C48H40BClN6O2 |
| Molecular Weight | 779.15 g/mol |
| Exact Mass | 778.30 |
| IUPAC Name | 2-(3-chlorophenyl)-4,6-diphenyl-1,3,5-triazine;2,4-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
| SMILES | CC1(C)OB(c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)OC1(C)C.Clc1cccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C27H26BN3O2.C21H14ClN3/c1-26(2)27(3,4)33-28(32-26)22-17-11-16-21(18-22)25-30-23(19-12-7-5-8-13-19)29-24(31-25)20-14-9-6-10-15-20;22-18-13-7-12-17(14-18)21-24-19(15-8-3-1-4-9-15)23-20(25-21)16-10-5-2-6-11-16/h5-18H,1-4H3;1-14H |
| InChIKey | ADQWLODYVBBCKL-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 95.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.15 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|