C20H36N2O4 — CID 157084675
2-amino-N-[6-(2-methoxyethoxy)-2-oxohexyl]-3-phenylpropanamide;methane (PubChem CID 157084675) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is 2-amino-N-[6-(2-methoxyethoxy)-2-oxohexyl]-3-phenylpropanamide;methane.
| Compound Name | 2-amino-N-[6-(2-methoxyethoxy)-2-oxohexyl]-3-phenylpropanamide;methane |
|---|---|
| PubChem CID | 157084675 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 2-amino-N-[6-(2-methoxyethoxy)-2-oxohexyl]-3-phenylpropanamide;methane |
| SMILES | C.C.COCCOCCCCC(=O)CNC(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C18H28N2O4.2CH4/c1-23-11-12-24-10-6-5-9-16(21)14-20-18(22)17(19)13-15-7-3-2-4-8-15;;/h2-4,7-8,17H,5-6,9-14,19H2,1H3,(H,20,22);2*1H4 |
| InChIKey | ADYLYKWNQXHSFD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|