C20H36N2O4 — CID 165007048
2-amino-N-[6-(3-hydroxypropoxy)-2-oxohexyl]-3-phenylpropanamide;methane (PubChem CID 165007048) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is 2-amino-N-[6-(3-hydroxypropoxy)-2-oxohexyl]-3-phenylpropanamide;methane.
| Compound Name | 2-amino-N-[6-(3-hydroxypropoxy)-2-oxohexyl]-3-phenylpropanamide;methane |
|---|---|
| PubChem CID | 165007048 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 2-amino-N-[6-(3-hydroxypropoxy)-2-oxohexyl]-3-phenylpropanamide;methane |
| SMILES | C.C.NC(Cc1ccccc1)C(=O)NCC(=O)CCCCOCCCO |
| InChI | InChI=1S/C18H28N2O4.2CH4/c19-17(13-15-7-2-1-3-8-15)18(23)20-14-16(22)9-4-5-11-24-12-6-10-21;;/h1-3,7-8,17,21H,4-6,9-14,19H2,(H,20,23);2*1H4 |
| InChIKey | JCRYUYZZZVZXTB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|