C35H22ClFN6 — CID 157085033
2-[3-(2-chlorophenyl)-1-(4-fluorophenyl)pyrazol-4-yl]-21,23-dihydroporphyrin (PubChem CID 157085033) has the molecular formula C35H22ClFN6 and a molecular weight of 581.05 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-1-(4-fluorophenyl)pyrazol-4-yl]-21,23-dihydroporphyrin.
| Compound Name | 2-[3-(2-chlorophenyl)-1-(4-fluorophenyl)pyrazol-4-yl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 157085033 |
| Molecular Formula | C35H22ClFN6 |
| Molecular Weight | 581.05 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-1-(4-fluorophenyl)pyrazol-4-yl]-21,23-dihydroporphyrin |
| SMILES | Fc1ccc(-n2cc(-c3cc4cc5nc(cc6ccc(cc7nc(cc3[nH]4)C=C7)[nH]6)C=C5)c(-c3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C35H22ClFN6/c36-33-4-2-1-3-30(33)35-32(20-43(42-35)29-13-5-21(37)6-14-29)31-18-28-17-26-10-9-24(39-26)15-22-7-8-23(38-22)16-25-11-12-27(40-25)19-34(31)41-28/h1-20,38,41H/b22-15-,23-16-,24-15-,25-16-,26-17-,27-19-,28-17-,34-19- |
| InChIKey | ADZKVAXHAKJEEY-LUCQOUKQSA-N |
| XLogP | 8.97 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.05 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |