C21H18ClFN4 — CID 45177647
1-(2-chloro-6-fluorophenyl)-2-(1H-pyrazol-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 45177647) has the molecular formula C21H18ClFN4 and a molecular weight of 380.85 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)-2-(1H-pyrazol-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(2-chloro-6-fluorophenyl)-2-(1H-pyrazol-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 45177647 |
| Molecular Formula | C21H18ClFN4 |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)-2-(1H-pyrazol-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Fc1cccc(Cl)c1C1c2[nH]c3ccccc3c2CCN1Cc1ccn[nH]1 |
| InChI | InChI=1S/C21H18ClFN4/c22-16-5-3-6-17(23)19(16)21-20-15(14-4-1-2-7-18(14)25-20)9-11-27(21)12-13-8-10-24-26-13/h1-8,10,21,25H,9,11-12H2,(H,24,26) |
| InChIKey | ZXUVVYHMGGODJH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|