C40H34Cl4N6O6 — CID 157086637
ethyl 5-amino-1-benzylimidazole-4-carboxylate;ethyl 1-benzyl-5-[bis(2,4-dichlorobenzoyl)amino]imidazole-4-carboxylate (PubChem CID 157086637) has the molecular formula C40H34Cl4N6O6 and a molecular weight of 836.56 g/mol. Its IUPAC name is ethyl 5-amino-1-benzylimidazole-4-carboxylate;ethyl 1-benzyl-5-[bis(2,4-dichlorobenzoyl)amino]imidazole-4-carboxylate.
| Compound Name | ethyl 5-amino-1-benzylimidazole-4-carboxylate;ethyl 1-benzyl-5-[bis(2,4-dichlorobenzoyl)amino]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 157086637 |
| Molecular Formula | C40H34Cl4N6O6 |
| Molecular Weight | 836.56 g/mol |
| Exact Mass | 834.13 |
| IUPAC Name | ethyl 5-amino-1-benzylimidazole-4-carboxylate;ethyl 1-benzyl-5-[bis(2,4-dichlorobenzoyl)amino]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncn(Cc2ccccc2)c1N.CCOC(=O)c1ncn(Cc2ccccc2)c1N(C(=O)c1ccc(Cl)cc1Cl)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H19Cl4N3O4.C13H15N3O2/c1-2-38-27(37)23-24(33(15-32-23)14-16-6-4-3-5-7-16)34(25(35)19-10-8-17(28)12-21(19)30)26(36)20-11-9-18(29)13-22(20)31;1-2-18-13(17)11-12(14)16(9-15-11)8-10-6-4-3-5-7-10/h3-13,15H,2,14H2,1H3;3-7,9H,2,8,14H2,1H3 |
| InChIKey | AEDXXFWILAOQCH-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 151.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.56 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|