C22H25Cl2NO3 — CID 20779311
tert-butyl 2-[(2,4-dichlorobenzoyl)-ethylamino]-3-phenylpropanoate (PubChem CID 20779311) has the molecular formula C22H25Cl2NO3 and a molecular weight of 422.35 g/mol. Its IUPAC name is tert-butyl 2-[(2,4-dichlorobenzoyl)-ethylamino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[(2,4-dichlorobenzoyl)-ethylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 20779311 |
| Molecular Formula | C22H25Cl2NO3 |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | tert-butyl 2-[(2,4-dichlorobenzoyl)-ethylamino]-3-phenylpropanoate |
| SMILES | CCN(C(=O)c1ccc(Cl)cc1Cl)C(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H25Cl2NO3/c1-5-25(20(26)17-12-11-16(23)14-18(17)24)19(21(27)28-22(2,3)4)13-15-9-7-6-8-10-15/h6-12,14,19H,5,13H2,1-4H3 |
| InChIKey | JEDOAOMBEBBHJY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |