C27H22Cl2N2O3S — CID 142192624
(2S)-2-[[3-(3-aminophenyl)thiophen-2-yl]methyl-(2,4-dichlorobenzoyl)amino]-3-phenylpropanoic acid (PubChem CID 142192624) has the molecular formula C27H22Cl2N2O3S and a molecular weight of 525.46 g/mol. Its IUPAC name is (2S)-2-[[3-(3-aminophenyl)thiophen-2-yl]methyl-(2,4-dichlorobenzoyl)amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[3-(3-aminophenyl)thiophen-2-yl]methyl-(2,4-dichlorobenzoyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 142192624 |
| Molecular Formula | C27H22Cl2N2O3S |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | (2S)-2-[[3-(3-aminophenyl)thiophen-2-yl]methyl-(2,4-dichlorobenzoyl)amino]-3-phenylpropanoic acid |
| SMILES | Nc1cccc(-c2ccsc2CN(C(=O)c2ccc(Cl)cc2Cl)[C@@H](Cc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C27H22Cl2N2O3S/c28-19-9-10-22(23(29)15-19)26(32)31(24(27(33)34)13-17-5-2-1-3-6-17)16-25-21(11-12-35-25)18-7-4-8-20(30)14-18/h1-12,14-15,24H,13,16,30H2,(H,33,34)/t24-/m0/s1 |
| InChIKey | ZQLLHYWPJLXJPY-DEOSSOPVSA-N |
| XLogP | 6.64 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|