C27H27Cl2NO3 — CID 20779317
tert-butyl 2-[benzyl-(2,4-dichlorobenzoyl)amino]-3-phenylpropanoate (PubChem CID 20779317) has the molecular formula C27H27Cl2NO3 and a molecular weight of 484.42 g/mol. Its IUPAC name is tert-butyl 2-[benzyl-(2,4-dichlorobenzoyl)amino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[benzyl-(2,4-dichlorobenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 20779317 |
| Molecular Formula | C27H27Cl2NO3 |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | tert-butyl 2-[benzyl-(2,4-dichlorobenzoyl)amino]-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H27Cl2NO3/c1-27(2,3)33-26(32)24(16-19-10-6-4-7-11-19)30(18-20-12-8-5-9-13-20)25(31)22-15-14-21(28)17-23(22)29/h4-15,17,24H,16,18H2,1-3H3 |
| InChIKey | VJHWAVCLPQRZRR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |