C24H19Cl2NO5 — CID 22490115
3-[[(1-carboxy-2-phenylethyl)-(2,4-dichlorobenzoyl)amino]methyl]benzoic acid (PubChem CID 22490115) has the molecular formula C24H19Cl2NO5 and a molecular weight of 472.32 g/mol. Its IUPAC name is 3-[[(1-carboxy-2-phenylethyl)-(2,4-dichlorobenzoyl)amino]methyl]benzoic acid.
| Compound Name | 3-[[(1-carboxy-2-phenylethyl)-(2,4-dichlorobenzoyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 22490115 |
| Molecular Formula | C24H19Cl2NO5 |
| Molecular Weight | 472.32 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | 3-[[(1-carboxy-2-phenylethyl)-(2,4-dichlorobenzoyl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN(C(=O)c2ccc(Cl)cc2Cl)C(Cc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C24H19Cl2NO5/c25-18-9-10-19(20(26)13-18)22(28)27(14-16-7-4-8-17(11-16)23(29)30)21(24(31)32)12-15-5-2-1-3-6-15/h1-11,13,21H,12,14H2,(H,29,30)(H,31,32) |
| InChIKey | HMVUPXMZPXMEDN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.32 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |