About 1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate
1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate (PubChem CID 157087035) has the molecular formula C30H28N2O2
and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate.
Molecular Properties
| Compound Name | 1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate |
| PubChem CID | 157087035 |
| Molecular Formula | C30H28N2O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate |
| SMILES | CCc1ccc(-c2ccc(CC)cc2)cc1.N#COc1ccccc1.N#COc1ccccc1 |
| InChI | InChI=1S/C16H18.2C7H5NO/c1-3-13-5-9-15(10-6-13)16-11-7-14(4-2)8-12-16;2*8-6-9-7-4-2-1-3-5-7/h5-12H,3-4H2,1-2H3;2*1-5H |
| InChIKey | AEFBUZGXHPSDIH-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate?
The IUPAC name of 1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate (CID 157087035) is 1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate.
What is the SMILES notation for 1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate?
The canonical SMILES for 1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate is CCc1ccc(-c2ccc(CC)cc2)cc1.N#COc1ccccc1.N#COc1ccccc1.
What is the InChIKey of 1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate?
The InChIKey is AEFBUZGXHPSDIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.2C7H5NO/c1-3-13-5-9-15(10-6-13)16-11-7-14(4-2)8-12-16;2*8-6-9-7-4-2-1-3-5-7/h5-12H,3-4H2,1-2H3;2*1-5H.
What are the key properties of 1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate?
1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate has a molecular weight of 448.57 g/mol, XLogP of 7.57, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-(4-ethylphenyl)benzene;phenyl cyanate is sourced from PubChem (CID 157087035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).