C25H32BN3O3 — CID 157087652
methyl-[4-[4-[6-(morpholin-4-ylmethyl)-5H-cyclopenta[c]pyridin-1-yl]phenoxy]piperidin-1-yl]borinic acid (PubChem CID 157087652) has the molecular formula C25H32BN3O3 and a molecular weight of 433.36 g/mol. Its IUPAC name is methyl-[4-[4-[6-(morpholin-4-ylmethyl)-5H-cyclopenta[c]pyridin-1-yl]phenoxy]piperidin-1-yl]borinic acid.
| Compound Name | methyl-[4-[4-[6-(morpholin-4-ylmethyl)-5H-cyclopenta[c]pyridin-1-yl]phenoxy]piperidin-1-yl]borinic acid |
|---|---|
| PubChem CID | 157087652 |
| Molecular Formula | C25H32BN3O3 |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | methyl-[4-[4-[6-(morpholin-4-ylmethyl)-5H-cyclopenta[c]pyridin-1-yl]phenoxy]piperidin-1-yl]borinic acid |
| SMILES | CB(O)N1CCC(Oc2ccc(-c3nccc4c3C=C(CN3CCOCC3)C4)cc2)CC1 |
| InChI | InChI=1S/C25H32BN3O3/c1-26(30)29-10-7-23(8-11-29)32-22-4-2-20(3-5-22)25-24-17-19(16-21(24)6-9-27-25)18-28-12-14-31-15-13-28/h2-6,9,17,23,30H,7-8,10-16,18H2,1H3 |
| InChIKey | UMXCVNAITPSGIX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|