C20H20F3N5O — CID 157096103
3-[[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]tetrazol-2-yl]methyl]pyrrolidin-3-ol (PubChem CID 157096103) has the molecular formula C20H20F3N5O and a molecular weight of 403.41 g/mol. Its IUPAC name is 3-[[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]tetrazol-2-yl]methyl]pyrrolidin-3-ol.
| Compound Name | 3-[[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]tetrazol-2-yl]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 157096103 |
| Molecular Formula | C20H20F3N5O |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 3-[[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]tetrazol-2-yl]methyl]pyrrolidin-3-ol |
| SMILES | OC1(Cn2nnc(-c3ccccc3Cc3ccc(C(F)(F)F)cc3)n2)CCNC1 |
| InChI | InChI=1S/C20H20F3N5O/c21-20(22,23)16-7-5-14(6-8-16)11-15-3-1-2-4-17(15)18-25-27-28(26-18)13-19(29)9-10-24-12-19/h1-8,24,29H,9-13H2 |
| InChIKey | WYVOQXZVCXYRDI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |