C21H16F3N5 — CID 161232525
3-[[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]tetrazol-2-yl]methyl]pyridine (PubChem CID 161232525) has the molecular formula C21H16F3N5 and a molecular weight of 395.39 g/mol. Its IUPAC name is 3-[[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]tetrazol-2-yl]methyl]pyridine.
| Compound Name | 3-[[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]tetrazol-2-yl]methyl]pyridine |
|---|---|
| PubChem CID | 161232525 |
| Molecular Formula | C21H16F3N5 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 3-[[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]tetrazol-2-yl]methyl]pyridine |
| SMILES | FC(F)(F)c1ccc(Cc2ccccc2-c2nnn(Cc3cccnc3)n2)cc1 |
| InChI | InChI=1S/C21H16F3N5/c22-21(23,24)18-9-7-15(8-10-18)12-17-5-1-2-6-19(17)20-26-28-29(27-20)14-16-4-3-11-25-13-16/h1-11,13H,12,14H2 |
| InChIKey | NFIVOJYDXDKCTD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |