C19H17F3N4OS — CID 159174513
3-[[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]tetrazol-2-yl]methyl]thietan-3-ol (PubChem CID 159174513) has the molecular formula C19H17F3N4OS and a molecular weight of 406.43 g/mol. Its IUPAC name is 3-[[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]tetrazol-2-yl]methyl]thietan-3-ol.
| Compound Name | 3-[[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]tetrazol-2-yl]methyl]thietan-3-ol |
|---|---|
| PubChem CID | 159174513 |
| Molecular Formula | C19H17F3N4OS |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 3-[[5-[2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]tetrazol-2-yl]methyl]thietan-3-ol |
| SMILES | OC1(Cn2nnc(-c3ccccc3Cc3ccc(C(F)(F)F)cc3)n2)CSC1 |
| InChI | InChI=1S/C19H17F3N4OS/c20-19(21,22)15-7-5-13(6-8-15)9-14-3-1-2-4-16(14)17-23-25-26(24-17)10-18(27)11-28-12-18/h1-8,27H,9-12H2 |
| InChIKey | KHNAGHNLHFRKOM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |