C16H14Cl2N4O — CID 162095401
2-[5-[2-[(3,4-dichlorophenyl)methyl]phenyl]tetrazol-2-yl]ethanol (PubChem CID 162095401) has the molecular formula C16H14Cl2N4O and a molecular weight of 349.22 g/mol. Its IUPAC name is 2-[5-[2-[(3,4-dichlorophenyl)methyl]phenyl]tetrazol-2-yl]ethanol.
| Compound Name | 2-[5-[2-[(3,4-dichlorophenyl)methyl]phenyl]tetrazol-2-yl]ethanol |
|---|---|
| PubChem CID | 162095401 |
| Molecular Formula | C16H14Cl2N4O |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-[5-[2-[(3,4-dichlorophenyl)methyl]phenyl]tetrazol-2-yl]ethanol |
| SMILES | OCCn1nnc(-c2ccccc2Cc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C16H14Cl2N4O/c17-14-6-5-11(10-15(14)18)9-12-3-1-2-4-13(12)16-19-21-22(20-16)7-8-23/h1-6,10,23H,7-9H2 |
| InChIKey | TWWOFJFOIHYTPE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |