C33H30ClN11O4 — CID 157096412
6-chloro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine;2-nitroaniline;6-[(2-nitrophenyl)methyl]-N-(pyridin-3-ylmethyl)pyrimidin-4-amine (PubChem CID 157096412) has the molecular formula C33H30ClN11O4 and a molecular weight of 680.13 g/mol. Its IUPAC name is 6-chloro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine;2-nitroaniline;6-[(2-nitrophenyl)methyl]-N-(pyridin-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine;2-nitroaniline;6-[(2-nitrophenyl)methyl]-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 157096412 |
| Molecular Formula | C33H30ClN11O4 |
| Molecular Weight | 680.13 g/mol |
| Exact Mass | 679.22 |
| IUPAC Name | 6-chloro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine;2-nitroaniline;6-[(2-nitrophenyl)methyl]-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
| SMILES | Clc1cc(NCc2cccnc2)ncn1.Nc1ccccc1[N+](=O)[O-].O=[N+]([O-])c1ccccc1Cc1cc(NCc2cccnc2)ncn1 |
| InChI | InChI=1S/C17H15N5O2.C10H9ClN4.C6H6N2O2/c23-22(24)16-6-2-1-5-14(16)8-15-9-17(21-12-20-15)19-11-13-4-3-7-18-10-13;11-9-4-10(15-7-14-9)13-6-8-2-1-3-12-5-8;7-5-3-1-2-4-6(5)8(9)10/h1-7,9-10,12H,8,11H2,(H,19,20,21);1-5,7H,6H2,(H,13,14,15);1-4H,7H2 |
| InChIKey | AFGKVRCSEJHKBT-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 213.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.13 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|