C8H19O3S- — CID 157096676
3,3-dimethylpentane-1-sulfonate;methane (PubChem CID 157096676) has the molecular formula C8H19O3S- and a molecular weight of 195.30 g/mol. Its IUPAC name is 3,3-dimethylpentane-1-sulfonate;methane.
| Compound Name | 3,3-dimethylpentane-1-sulfonate;methane |
|---|---|
| PubChem CID | 157096676 |
| Molecular Formula | C8H19O3S- |
| Molecular Weight | 195.30 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 3,3-dimethylpentane-1-sulfonate;methane |
| SMILES | C.CCC(C)(C)CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H16O3S.CH4/c1-4-7(2,3)5-6-11(8,9)10;/h4-6H2,1-3H3,(H,8,9,10);1H4/p-1 |
| InChIKey | AFHFNDQVKZVGMY-UHFFFAOYSA-M |
| XLogP | 1.99 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|