C25H28F3NO2 — CID 157099128
1-[4-[(2,2-difluorocyclopropyl)methoxy]-2-fluorophenyl]-3-[4-[(2R)-4-methylpent-4-en-2-yl]phenoxy]azetidine (PubChem CID 157099128) has the molecular formula C25H28F3NO2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 1-[4-[(2,2-difluorocyclopropyl)methoxy]-2-fluorophenyl]-3-[4-[(2R)-4-methylpent-4-en-2-yl]phenoxy]azetidine.
| Compound Name | 1-[4-[(2,2-difluorocyclopropyl)methoxy]-2-fluorophenyl]-3-[4-[(2R)-4-methylpent-4-en-2-yl]phenoxy]azetidine |
|---|---|
| PubChem CID | 157099128 |
| Molecular Formula | C25H28F3NO2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 1-[4-[(2,2-difluorocyclopropyl)methoxy]-2-fluorophenyl]-3-[4-[(2R)-4-methylpent-4-en-2-yl]phenoxy]azetidine |
| SMILES | C=C(C)C[C@@H](C)c1ccc(OC2CN(c3ccc(OCC4CC4(F)F)cc3F)C2)cc1 |
| InChI | InChI=1S/C25H28F3NO2/c1-16(2)10-17(3)18-4-6-20(7-5-18)31-22-13-29(14-22)24-9-8-21(11-23(24)26)30-15-19-12-25(19,27)28/h4-9,11,17,19,22H,1,10,12-15H2,2-3H3/t17-,19?/m1/s1 |
| InChIKey | AFOHKNRCUNXYFY-DUSLRRAJSA-N |
| XLogP | 6.20 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|