C26H33NO2 — CID 161083204
1-(4-cyclopropyloxy-2-methylphenyl)-3-[4-[(2R)-4-methylpent-4-en-2-yl]phenoxy]pyrrolidine (PubChem CID 161083204) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-(4-cyclopropyloxy-2-methylphenyl)-3-[4-[(2R)-4-methylpent-4-en-2-yl]phenoxy]pyrrolidine.
| Compound Name | 1-(4-cyclopropyloxy-2-methylphenyl)-3-[4-[(2R)-4-methylpent-4-en-2-yl]phenoxy]pyrrolidine |
|---|---|
| PubChem CID | 161083204 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 1-(4-cyclopropyloxy-2-methylphenyl)-3-[4-[(2R)-4-methylpent-4-en-2-yl]phenoxy]pyrrolidine |
| SMILES | C=C(C)C[C@@H](C)c1ccc(OC2CCN(c3ccc(OC4CC4)cc3C)C2)cc1 |
| InChI | InChI=1S/C26H33NO2/c1-18(2)15-19(3)21-5-7-22(8-6-21)29-25-13-14-27(17-25)26-12-11-24(16-20(26)4)28-23-9-10-23/h5-8,11-12,16,19,23,25H,1,9-10,13-15,17H2,2-4H3/t19-,25?/m1/s1 |
| InChIKey | VVCVRGXNEZKJRM-OEPVSBQMSA-N |
| XLogP | 6.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|