C29H30N2O5 — CID 157100110
4-[6-methoxy-4-[(2-methyl-1H-inden-5-yl)oxy]quinolin-7-yl]oxy-1-(2-oxa-6-azaspiro[3.3]heptan-6-yl)butan-1-one (PubChem CID 157100110) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is 4-[6-methoxy-4-[(2-methyl-1H-inden-5-yl)oxy]quinolin-7-yl]oxy-1-(2-oxa-6-azaspiro[3.3]heptan-6-yl)butan-1-one.
| Compound Name | 4-[6-methoxy-4-[(2-methyl-1H-inden-5-yl)oxy]quinolin-7-yl]oxy-1-(2-oxa-6-azaspiro[3.3]heptan-6-yl)butan-1-one |
|---|---|
| PubChem CID | 157100110 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 4-[6-methoxy-4-[(2-methyl-1H-inden-5-yl)oxy]quinolin-7-yl]oxy-1-(2-oxa-6-azaspiro[3.3]heptan-6-yl)butan-1-one |
| SMILES | COc1cc2c(Oc3ccc4c(c3)C=C(C)C4)ccnc2cc1OCCCC(=O)N1CC2(COC2)C1 |
| InChI | InChI=1S/C29H30N2O5/c1-19-10-20-5-6-22(12-21(20)11-19)36-25-7-8-30-24-14-27(26(33-2)13-23(24)25)35-9-3-4-28(32)31-15-29(16-31)17-34-18-29/h5-8,11-14H,3-4,9-10,15-18H2,1-2H3 |
| InChIKey | VEGMYGIZROMJOH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|