C30H42N2O5 — CID 144685643
4-[6-methoxy-4-(7-methyloct-3-en-4-yloxy)quinolin-7-yl]oxy-1-(2-oxa-7-azaspiro[3.5]nonan-7-yl)butan-1-one (PubChem CID 144685643) has the molecular formula C30H42N2O5 and a molecular weight of 510.68 g/mol. Its IUPAC name is 4-[6-methoxy-4-(7-methyloct-3-en-4-yloxy)quinolin-7-yl]oxy-1-(2-oxa-7-azaspiro[3.5]nonan-7-yl)butan-1-one.
| Compound Name | 4-[6-methoxy-4-(7-methyloct-3-en-4-yloxy)quinolin-7-yl]oxy-1-(2-oxa-7-azaspiro[3.5]nonan-7-yl)butan-1-one |
|---|---|
| PubChem CID | 144685643 |
| Molecular Formula | C30H42N2O5 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | 4-[6-methoxy-4-(7-methyloct-3-en-4-yloxy)quinolin-7-yl]oxy-1-(2-oxa-7-azaspiro[3.5]nonan-7-yl)butan-1-one |
| SMILES | CCC=C(CCC(C)C)Oc1ccnc2cc(OCCCC(=O)N3CCC4(CC3)COC4)c(OC)cc12 |
| InChI | InChI=1S/C30H42N2O5/c1-5-7-23(10-9-22(2)3)37-26-11-14-31-25-19-28(27(34-4)18-24(25)26)36-17-6-8-29(33)32-15-12-30(13-16-32)20-35-21-30/h7,11,14,18-19,22H,5-6,8-10,12-13,15-17,20-21H2,1-4H3 |
| InChIKey | PSIPJQCXUVNIQF-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|