About carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate
carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate (PubChem CID 157101002) has the molecular formula C17H14Cl2F2O4
and a molecular weight of 391.20 g/mol. Its IUPAC name is carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate.
Molecular Properties
| Compound Name | carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate |
| PubChem CID | 157101002 |
| Molecular Formula | C17H14Cl2F2O4 |
| Molecular Weight | 391.20 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate |
| SMILES | CCc1ccc(Cl)cc1F.O=C=O.O=COCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C8H6ClFO2.C8H8ClF.CO2/c9-7-2-1-6(4-12-5-11)8(10)3-7;1-2-6-3-4-7(9)5-8(6)10;2-1-3/h1-3,5H,4H2;3-5H,2H2,1H3; |
| InChIKey | AFTKPTJRNNQNRQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.20 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate?
The IUPAC name of carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate (CID 157101002) is carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate.
What is the SMILES notation for carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate?
The canonical SMILES for carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate is CCc1ccc(Cl)cc1F.O=C=O.O=COCc1ccc(Cl)cc1F.
What is the InChIKey of carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate?
The InChIKey is AFTKPTJRNNQNRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClFO2.C8H8ClF.CO2/c9-7-2-1-6(4-12-5-11)8(10)3-7;1-2-6-3-4-7(9)5-8(6)10;2-1-3/h1-3,5H,4H2;3-5H,2H2,1H3;.
What are the key properties of carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate?
carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate has a molecular weight of 391.20 g/mol, XLogP of 4.61, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;4-chloro-1-ethyl-2-fluorobenzene;(4-chloro-2-fluorophenyl)methyl formate is sourced from PubChem (CID 157101002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).