C51H62F2N4O6 — CID 157105757
tert-butyl 4-[4-fluoro-3-[(6-oxo-6-phenylhexanoyl)amino]phenyl]piperidine-1-carboxylate;N-(2-fluoro-5-piperidin-4-ylphenyl)-6-oxo-6-phenylhexanamide (PubChem CID 157105757) has the molecular formula C51H62F2N4O6 and a molecular weight of 865.07 g/mol. Its IUPAC name is tert-butyl 4-[4-fluoro-3-[(6-oxo-6-phenylhexanoyl)amino]phenyl]piperidine-1-carboxylate;N-(2-fluoro-5-piperidin-4-ylphenyl)-6-oxo-6-phenylhexanamide.
| Compound Name | tert-butyl 4-[4-fluoro-3-[(6-oxo-6-phenylhexanoyl)amino]phenyl]piperidine-1-carboxylate;N-(2-fluoro-5-piperidin-4-ylphenyl)-6-oxo-6-phenylhexanamide |
|---|---|
| PubChem CID | 157105757 |
| Molecular Formula | C51H62F2N4O6 |
| Molecular Weight | 865.07 g/mol |
| Exact Mass | 864.46 |
| IUPAC Name | tert-butyl 4-[4-fluoro-3-[(6-oxo-6-phenylhexanoyl)amino]phenyl]piperidine-1-carboxylate;N-(2-fluoro-5-piperidin-4-ylphenyl)-6-oxo-6-phenylhexanamide |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(F)c(NC(=O)CCCCC(=O)c3ccccc3)c2)CC1.O=C(CCCCC(=O)c1ccccc1)Nc1cc(C2CCNCC2)ccc1F |
| InChI | InChI=1S/C28H35FN2O4.C23H27FN2O2/c1-28(2,3)35-27(34)31-17-15-20(16-18-31)22-13-14-23(29)24(19-22)30-26(33)12-8-7-11-25(32)21-9-5-4-6-10-21;24-20-11-10-19(17-12-14-25-15-13-17)16-21(20)26-23(28)9-5-4-8-22(27)18-6-2-1-3-7-18/h4-6,9-10,13-14,19-20H,7-8,11-12,15-18H2,1-3H3,(H,30,33);1-3,6-7,10-11,16-17,25H,4-5,8-9,12-15H2,(H,26,28) |
| InChIKey | AGGZELBXFMZHSI-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.07 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|