C34H32N4O5 — CID 157117278
9H-fluoren-9-ylmethyl 4-[[4-[(3-nitro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methyl]benzoyl]amino]butanoate (PubChem CID 157117278) has the molecular formula C34H32N4O5 and a molecular weight of 576.65 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 4-[[4-[(3-nitro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methyl]benzoyl]amino]butanoate.
| Compound Name | 9H-fluoren-9-ylmethyl 4-[[4-[(3-nitro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methyl]benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 157117278 |
| Molecular Formula | C34H32N4O5 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 4-[[4-[(3-nitro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methyl]benzoyl]amino]butanoate |
| SMILES | O=C(CCCNC(=O)c1ccc(CN2CCc3ncc([N+](=O)[O-])cc3C2)cc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H32N4O5/c39-33(43-22-31-29-8-3-1-6-27(29)28-7-2-4-9-30(28)31)10-5-16-35-34(40)24-13-11-23(12-14-24)20-37-17-15-32-25(21-37)18-26(19-36-32)38(41)42/h1-4,6-9,11-14,18-19,31H,5,10,15-17,20-22H2,(H,35,40) |
| InChIKey | DTOXVPPQXLQEHH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|