C19H25N3 — CID 157119078
4-(cyclohexylmethyl)-6-(2,3-dimethylphenyl)pyrimidin-2-amine (PubChem CID 157119078) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-6-(2,3-dimethylphenyl)pyrimidin-2-amine.
| Compound Name | 4-(cyclohexylmethyl)-6-(2,3-dimethylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 157119078 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 4-(cyclohexylmethyl)-6-(2,3-dimethylphenyl)pyrimidin-2-amine |
| SMILES | Cc1cccc(-c2cc(CC3CCCCC3)nc(N)n2)c1C |
| InChI | InChI=1S/C19H25N3/c1-13-7-6-10-17(14(13)2)18-12-16(21-19(20)22-18)11-15-8-4-3-5-9-15/h6-7,10,12,15H,3-5,8-9,11H2,1-2H3,(H2,20,21,22) |
| InChIKey | HGGNTFKTWAHYBH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |