C29H21BrN8O7S — CID 157120953
4-bromo-3-nitro-1H-indole-7-carboxamide;N-[3-(7-carbamoyl-3-nitro-1H-indol-4-yl)-2-methylphenyl]-1,3-thiazole-2-carboxamide (PubChem CID 157120953) has the molecular formula C29H21BrN8O7S and a molecular weight of 705.51 g/mol. Its IUPAC name is 4-bromo-3-nitro-1H-indole-7-carboxamide;N-[3-(7-carbamoyl-3-nitro-1H-indol-4-yl)-2-methylphenyl]-1,3-thiazole-2-carboxamide.
| Compound Name | 4-bromo-3-nitro-1H-indole-7-carboxamide;N-[3-(7-carbamoyl-3-nitro-1H-indol-4-yl)-2-methylphenyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 157120953 |
| Molecular Formula | C29H21BrN8O7S |
| Molecular Weight | 705.51 g/mol |
| Exact Mass | 704.04 |
| IUPAC Name | 4-bromo-3-nitro-1H-indole-7-carboxamide;N-[3-(7-carbamoyl-3-nitro-1H-indol-4-yl)-2-methylphenyl]-1,3-thiazole-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2nccs2)cccc1-c1ccc(C(N)=O)c2[nH]cc([N+](=O)[O-])c12.NC(=O)c1ccc(Br)c2c([N+](=O)[O-])c[nH]c12 |
| InChI | InChI=1S/C20H15N5O4S.C9H6BrN3O3/c1-10-11(3-2-4-14(10)24-19(27)20-22-7-8-30-20)12-5-6-13(18(21)26)17-16(12)15(9-23-17)25(28)29;10-5-2-1-4(9(11)14)8-7(5)6(3-12-8)13(15)16/h2-9,23H,1H3,(H2,21,26)(H,24,27);1-3,12H,(H2,11,14) |
| InChIKey | AHYTYZFPPUOCPD-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 246.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|