C31H27N5O3S — CID 123654239
N-[3-[2-[2-[(but-2-enoylamino)methyl]phenyl]-7-carbamoyl-1H-indol-4-yl]-2-methylphenyl]-1,3-thiazole-2-carboxamide (PubChem CID 123654239) has the molecular formula C31H27N5O3S and a molecular weight of 549.66 g/mol. Its IUPAC name is N-[3-[2-[2-[(but-2-enoylamino)methyl]phenyl]-7-carbamoyl-1H-indol-4-yl]-2-methylphenyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-[3-[2-[2-[(but-2-enoylamino)methyl]phenyl]-7-carbamoyl-1H-indol-4-yl]-2-methylphenyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 123654239 |
| Molecular Formula | C31H27N5O3S |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | N-[3-[2-[2-[(but-2-enoylamino)methyl]phenyl]-7-carbamoyl-1H-indol-4-yl]-2-methylphenyl]-1,3-thiazole-2-carboxamide |
| SMILES | CC=CC(=O)NCc1ccccc1-c1cc2c(-c3cccc(NC(=O)c4nccs4)c3C)ccc(C(N)=O)c2[nH]1 |
| InChI | InChI=1S/C31H27N5O3S/c1-3-7-27(37)34-17-19-8-4-5-9-21(19)26-16-24-22(12-13-23(29(32)38)28(24)35-26)20-10-6-11-25(18(20)2)36-30(39)31-33-14-15-40-31/h3-16,35H,17H2,1-2H3,(H2,32,38)(H,34,37)(H,36,39) |
| InChIKey | DTIYKRUUXOQEPS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|