C24H21N5O2 — CID 174783807
4-[2-(aminomethyl)phenyl]-2-pyridin-4-yl-1H-indole-7-carboxamide;1H-azet-2-one (PubChem CID 174783807) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 4-[2-(aminomethyl)phenyl]-2-pyridin-4-yl-1H-indole-7-carboxamide;1H-azet-2-one.
| Compound Name | 4-[2-(aminomethyl)phenyl]-2-pyridin-4-yl-1H-indole-7-carboxamide;1H-azet-2-one |
|---|---|
| PubChem CID | 174783807 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 4-[2-(aminomethyl)phenyl]-2-pyridin-4-yl-1H-indole-7-carboxamide;1H-azet-2-one |
| SMILES | NCc1ccccc1-c1ccc(C(N)=O)c2[nH]c(-c3ccncc3)cc12.O=C1C=CN1 |
| InChI | InChI=1S/C21H18N4O.C3H3NO/c22-12-14-3-1-2-4-15(14)16-5-6-17(21(23)26)20-18(16)11-19(25-20)13-7-9-24-10-8-13;5-3-1-2-4-3/h1-11,25H,12,22H2,(H2,23,26);1-2H,(H,4,5) |
| InChIKey | XIURFGOGPVEWNW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |