C28H20N6O2 — CID 86763132
4-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-2-pyrimidin-5-yl-1H-indole-7-carboxamide (PubChem CID 86763132) has the molecular formula C28H20N6O2 and a molecular weight of 472.51 g/mol. Its IUPAC name is 4-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-2-pyrimidin-5-yl-1H-indole-7-carboxamide.
| Compound Name | 4-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-2-pyrimidin-5-yl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 86763132 |
| Molecular Formula | C28H20N6O2 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 4-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-2-pyrimidin-5-yl-1H-indole-7-carboxamide |
| SMILES | Cc1c(-c2ccc(C(N)=O)c3[nH]c(-c4cncnc4)cc23)cccc1-n1cnc2ccccc2c1=O |
| InChI | InChI=1S/C28H20N6O2/c1-16-18(6-4-8-25(16)34-15-32-23-7-3-2-5-20(23)28(34)36)19-9-10-21(27(29)35)26-22(19)11-24(33-26)17-12-30-14-31-13-17/h2-15,33H,1H3,(H2,29,35) |
| InChIKey | HLLWUYRSVBFCPR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |