C30H28N6O3 — CID 139501178
2-[(E)-1-[2-hydroxyethyl-(methylideneamino)amino]prop-1-en-2-yl]-4-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-1H-indole-7-carboxamide (PubChem CID 139501178) has the molecular formula C30H28N6O3 and a molecular weight of 520.59 g/mol. Its IUPAC name is 2-[(E)-1-[2-hydroxyethyl-(methylideneamino)amino]prop-1-en-2-yl]-4-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-1H-indole-7-carboxamide.
| Compound Name | 2-[(E)-1-[2-hydroxyethyl-(methylideneamino)amino]prop-1-en-2-yl]-4-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 139501178 |
| Molecular Formula | C30H28N6O3 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 2-[(E)-1-[2-hydroxyethyl-(methylideneamino)amino]prop-1-en-2-yl]-4-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-1H-indole-7-carboxamide |
| SMILES | C=NN(/C=C(\C)c1cc2c(-c3cccc(-n4cnc5ccccc5c4=O)c3C)ccc(C(N)=O)c2[nH]1)CCO |
| InChI | InChI=1S/C30H28N6O3/c1-18(16-35(32-3)13-14-37)26-15-24-21(11-12-23(29(31)38)28(24)34-26)20-8-6-10-27(19(20)2)36-17-33-25-9-5-4-7-22(25)30(36)39/h4-12,15-17,34,37H,3,13-14H2,1-2H3,(H2,31,38)/b18-16+ |
| InChIKey | ZRPLPQXPKXQAPP-FBMGVBCBSA-N |
| XLogP | 4.21 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|