C24H17FN4O2 — CID 121293860
4-[3-(6-fluoro-4-oxoquinazolin-3-yl)-2-methylphenyl]-1H-indole-7-carboxamide (PubChem CID 121293860) has the molecular formula C24H17FN4O2 and a molecular weight of 412.42 g/mol. Its IUPAC name is 4-[3-(6-fluoro-4-oxoquinazolin-3-yl)-2-methylphenyl]-1H-indole-7-carboxamide.
| Compound Name | 4-[3-(6-fluoro-4-oxoquinazolin-3-yl)-2-methylphenyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 121293860 |
| Molecular Formula | C24H17FN4O2 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-[3-(6-fluoro-4-oxoquinazolin-3-yl)-2-methylphenyl]-1H-indole-7-carboxamide |
| SMILES | Cc1c(-c2ccc(C(N)=O)c3[nH]ccc23)cccc1-n1cnc2ccc(F)cc2c1=O |
| InChI | InChI=1S/C24H17FN4O2/c1-13-15(16-6-7-18(23(26)30)22-17(16)9-10-27-22)3-2-4-21(13)29-12-28-20-8-5-14(25)11-19(20)24(29)31/h2-12,27H,1H3,(H2,26,30) |
| InChIKey | CNBIPBLHXWHWJD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |