C27H22N7O2+ — CID 163411671
7-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-2-(2-methyl-1H-pyrazol-2-ium-4-yl)-1H-benzimidazole-4-carboxamide (PubChem CID 163411671) has the molecular formula C27H22N7O2+ and a molecular weight of 476.52 g/mol. Its IUPAC name is 7-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-2-(2-methyl-1H-pyrazol-2-ium-4-yl)-1H-benzimidazole-4-carboxamide.
| Compound Name | 7-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-2-(2-methyl-1H-pyrazol-2-ium-4-yl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 163411671 |
| Molecular Formula | C27H22N7O2+ |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 7-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-2-(2-methyl-1H-pyrazol-2-ium-4-yl)-1H-benzimidazole-4-carboxamide |
| SMILES | Cc1c(-c2ccc(C(N)=O)c3nc(-c4c[nH][n+](C)c4)[nH]c23)cccc1-n1cnc2ccccc2c1=O |
| InChI | InChI=1S/C27H21N7O2/c1-15-17(7-5-9-22(15)34-14-29-21-8-4-3-6-19(21)27(34)36)18-10-11-20(25(28)35)24-23(18)31-26(32-24)16-12-30-33(2)13-16/h3-14H,1-2H3,(H3,28,31,32,35)/p+1 |
| InChIKey | WEXWHEDFXTWOON-UHFFFAOYSA-O |
| XLogP | 3.16 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|